C20H19ClN2O2 — CID 53382909
N-butyl-5-(4-chlorophenyl)-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 53382909) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is N-butyl-5-(4-chlorophenyl)-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-butyl-5-(4-chlorophenyl)-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53382909 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-butyl-5-(4-chlorophenyl)-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1nc(-c2ccccc2)oc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-2-3-13-22-19(24)17-18(14-9-11-16(21)12-10-14)25-20(23-17)15-7-5-4-6-8-15/h4-12H,2-3,13H2,1H3,(H,22,24) |
| InChIKey | JIRYWVSLTSGJIL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|