C25H28ClN3O4S — CID 53382912
N-butyl-2-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 53382912) has the molecular formula C25H28ClN3O4S and a molecular weight of 502.04 g/mol. Its IUPAC name is N-butyl-2-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-butyl-2-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53382912 |
| Molecular Formula | C25H28ClN3O4S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | N-butyl-2-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-5-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1nc(C2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)oc1-c1ccccc1 |
| InChI | InChI=1S/C25H28ClN3O4S/c1-2-3-15-27-24(30)22-23(18-7-5-4-6-8-18)33-25(28-22)19-13-16-29(17-14-19)34(31,32)21-11-9-20(26)10-12-21/h4-12,19H,2-3,13-17H2,1H3,(H,27,30) |
| InChIKey | BNZQSLYMAXKDPH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|