C26H28F3N3O4S — CID 51361506
2-[1-(benzenesulfonyl)piperidin-4-yl]-N-butyl-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 51361506) has the molecular formula C26H28F3N3O4S and a molecular weight of 535.59 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)piperidin-4-yl]-N-butyl-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[1-(benzenesulfonyl)piperidin-4-yl]-N-butyl-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 51361506 |
| Molecular Formula | C26H28F3N3O4S |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 2-[1-(benzenesulfonyl)piperidin-4-yl]-N-butyl-5-[3-(trifluoromethyl)phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1nc(C2CCN(S(=O)(=O)c3ccccc3)CC2)oc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H28F3N3O4S/c1-2-3-14-30-24(33)22-23(19-8-7-9-20(17-19)26(27,28)29)36-25(31-22)18-12-15-32(16-13-18)37(34,35)21-10-5-4-6-11-21/h4-11,17-18H,2-3,12-16H2,1H3,(H,30,33) |
| InChIKey | SNCFHOIHBNHVSE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|