About N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide
N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide (PubChem CID 71729449) has the molecular formula C22H22F3N3O
and a molecular weight of 401.43 g/mol. Its IUPAC name is N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide.
Molecular Properties
| Compound Name | N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide |
| PubChem CID | 71729449 |
| Molecular Formula | C22H22F3N3O |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide |
| SMILES | CCCCNC(=O)c1nc2cc(C)c(C)cc2nc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F3N3O/c1-4-5-9-26-21(29)20-19(15-7-6-8-16(12-15)22(23,24)25)27-17-10-13(2)14(3)11-18(17)28-20/h6-8,10-12H,4-5,9H2,1-3H3,(H,26,29) |
| InChIKey | URMURACPSYPHJQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide?
The IUPAC name of N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide (CID 71729449) is N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide.
What is the SMILES notation for N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide?
The canonical SMILES for N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide is CCCCNC(=O)c1nc2cc(C)c(C)cc2nc1-c1cccc(C(F)(F)F)c1.
What is the InChIKey of N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide?
The InChIKey is URMURACPSYPHJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F3N3O/c1-4-5-9-26-21(29)20-19(15-7-6-8-16(12-15)22(23,24)25)27-17-10-13(2)14(3)11-18(17)28-20/h6-8,10-12H,4-5,9H2,1-3H3,(H,26,29).
What are the key properties of N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide?
N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide has a molecular weight of 401.43 g/mol, XLogP of 5.46, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6,7-dimethyl-3-[3-(trifluoromethyl)phenyl]quinoxaline-2-carboxamide is sourced from PubChem (CID 71729449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).