C16H18F3N3OS — CID 139948557
N-[3-(dimethylamino)propyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 139948557) has the molecular formula C16H18F3N3OS and a molecular weight of 357.40 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 139948557 |
| Molecular Formula | C16H18F3N3OS |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1csc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C16H18F3N3OS/c1-22(2)8-4-7-20-14(23)13-10-24-15(21-13)11-5-3-6-12(9-11)16(17,18)19/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,20,23) |
| InChIKey | OKCYIZJZXMHPSP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|