C14H16Cl2F3N3OS — CID 119408105
N-(3-aminopropyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119408105) has the molecular formula C14H16Cl2F3N3OS and a molecular weight of 402.27 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | N-(3-aminopropyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119408105 |
| Molecular Formula | C14H16Cl2F3N3OS |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N-(3-aminopropyl)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCNC(=O)c1csc(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C14H14F3N3OS.2ClH/c15-14(16,17)10-4-1-3-9(7-10)13-20-11(8-22-13)12(21)19-6-2-5-18;;/h1,3-4,7-8H,2,5-6,18H2,(H,19,21);2*1H |
| InChIKey | NCWYKCWTPOTERG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|