C22H20F3NO3 — CID 67384427
methyl 3-methyl-7-propoxy-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylate (PubChem CID 67384427) has the molecular formula C22H20F3NO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is methyl 3-methyl-7-propoxy-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylate.
| Compound Name | methyl 3-methyl-7-propoxy-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 67384427 |
| Molecular Formula | C22H20F3NO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | methyl 3-methyl-7-propoxy-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylate |
| SMILES | CCCOc1ccc2c(C(=O)OC)c(C)c(-c3cccc(C(F)(F)F)c3)nc2c1 |
| InChI | InChI=1S/C22H20F3NO3/c1-4-10-29-16-8-9-17-18(12-16)26-20(13(2)19(17)21(27)28-3)14-6-5-7-15(11-14)22(23,24)25/h5-9,11-12H,4,10H2,1-3H3 |
| InChIKey | VSXGWLJDIVRMNL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |