C18H12F3NO5S — CID 87379849
3-methyl-6-sulfo-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid (PubChem CID 87379849) has the molecular formula C18H12F3NO5S and a molecular weight of 411.36 g/mol. Its IUPAC name is 3-methyl-6-sulfo-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid.
| Compound Name | 3-methyl-6-sulfo-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 87379849 |
| Molecular Formula | C18H12F3NO5S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 3-methyl-6-sulfo-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid |
| SMILES | Cc1c(-c2cccc(C(F)(F)F)c2)nc2ccc(S(=O)(=O)O)cc2c1C(=O)O |
| InChI | InChI=1S/C18H12F3NO5S/c1-9-15(17(23)24)13-8-12(28(25,26)27)5-6-14(13)22-16(9)10-3-2-4-11(7-10)18(19,20)21/h2-8H,1H3,(H,23,24)(H,25,26,27) |
| InChIKey | DBZOZTNWZVUDIZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 104.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|