C19H26N4O4S — CID 146087662
2-[5-[1-(benzenesulfonyl)piperidin-3-yl]-1,2,4-oxadiazol-3-yl]-N-butylacetamide (PubChem CID 146087662) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[5-[1-(benzenesulfonyl)piperidin-3-yl]-1,2,4-oxadiazol-3-yl]-N-butylacetamide.
| Compound Name | 2-[5-[1-(benzenesulfonyl)piperidin-3-yl]-1,2,4-oxadiazol-3-yl]-N-butylacetamide |
|---|---|
| PubChem CID | 146087662 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[5-[1-(benzenesulfonyl)piperidin-3-yl]-1,2,4-oxadiazol-3-yl]-N-butylacetamide |
| SMILES | CCCCNC(=O)Cc1noc(C2CCCN(S(=O)(=O)c3ccccc3)C2)n1 |
| InChI | InChI=1S/C19H26N4O4S/c1-2-3-11-20-18(24)13-17-21-19(27-22-17)15-8-7-12-23(14-15)28(25,26)16-9-5-4-6-10-16/h4-6,9-10,15H,2-3,7-8,11-14H2,1H3,(H,20,24) |
| InChIKey | CXKMPPYBFDDQLD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|