C26H31N3O6S2 — CID 53382913
N-butyl-2-[1-(4-methylsulfonylphenyl)sulfonylpiperidin-4-yl]-5-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 53382913) has the molecular formula C26H31N3O6S2 and a molecular weight of 545.68 g/mol. Its IUPAC name is N-butyl-2-[1-(4-methylsulfonylphenyl)sulfonylpiperidin-4-yl]-5-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-butyl-2-[1-(4-methylsulfonylphenyl)sulfonylpiperidin-4-yl]-5-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53382913 |
| Molecular Formula | C26H31N3O6S2 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | N-butyl-2-[1-(4-methylsulfonylphenyl)sulfonylpiperidin-4-yl]-5-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1nc(C2CCN(S(=O)(=O)c3ccc(S(C)(=O)=O)cc3)CC2)oc1-c1ccccc1 |
| InChI | InChI=1S/C26H31N3O6S2/c1-3-4-16-27-25(30)23-24(19-8-6-5-7-9-19)35-26(28-23)20-14-17-29(18-15-20)37(33,34)22-12-10-21(11-13-22)36(2,31)32/h5-13,20H,3-4,14-18H2,1-2H3,(H,27,30) |
| InChIKey | ALZIZTVBTOUAOP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|