C18H23N3O4S — CID 96580597
N-[(3R)-1-(benzenesulfonyl)azepan-3-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 96580597) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[(3R)-1-(benzenesulfonyl)azepan-3-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | N-[(3R)-1-(benzenesulfonyl)azepan-3-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 96580597 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[(3R)-1-(benzenesulfonyl)azepan-3-yl]-2-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | Cc1cc(CC(=O)N[C@@H]2CCCCN(S(=O)(=O)c3ccccc3)C2)on1 |
| InChI | InChI=1S/C18H23N3O4S/c1-14-11-16(25-20-14)12-18(22)19-15-7-5-6-10-21(13-15)26(23,24)17-8-3-2-4-9-17/h2-4,8-9,11,15H,5-7,10,12-13H2,1H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | DXKVRMNSYWCWBS-OAHLLOKOSA-N |
| XLogP | 1.89 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |