C34H44N4O6 — CID 101061868
2-(decanoylamino)-5-[3-[(2,5-diphenyl-1,3-oxazole-4-carbonyl)amino]propylamino]-5-oxopentanoic acid (PubChem CID 101061868) has the molecular formula C34H44N4O6 and a molecular weight of 604.75 g/mol. Its IUPAC name is 2-(decanoylamino)-5-[3-[(2,5-diphenyl-1,3-oxazole-4-carbonyl)amino]propylamino]-5-oxopentanoic acid.
| Compound Name | 2-(decanoylamino)-5-[3-[(2,5-diphenyl-1,3-oxazole-4-carbonyl)amino]propylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 101061868 |
| Molecular Formula | C34H44N4O6 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | 2-(decanoylamino)-5-[3-[(2,5-diphenyl-1,3-oxazole-4-carbonyl)amino]propylamino]-5-oxopentanoic acid |
| SMILES | CCCCCCCCCC(=O)NC(CCC(=O)NCCCNC(=O)c1nc(-c2ccccc2)oc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C34H44N4O6/c1-2-3-4-5-6-7-14-20-29(40)37-27(34(42)43)21-22-28(39)35-23-15-24-36-32(41)30-31(25-16-10-8-11-17-25)44-33(38-30)26-18-12-9-13-19-26/h8-13,16-19,27H,2-7,14-15,20-24H2,1H3,(H,35,39)(H,36,41)(H,37,40)(H,42,43) |
| InChIKey | REMPGNYRDOMLSP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 150.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|