C19H24N2O4 — CID 120535696
8-[(2-methyl-5-phenyl-1,3-oxazole-4-carbonyl)amino]octanoic acid (PubChem CID 120535696) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 8-[(2-methyl-5-phenyl-1,3-oxazole-4-carbonyl)amino]octanoic acid.
| Compound Name | 8-[(2-methyl-5-phenyl-1,3-oxazole-4-carbonyl)amino]octanoic acid |
|---|---|
| PubChem CID | 120535696 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 8-[(2-methyl-5-phenyl-1,3-oxazole-4-carbonyl)amino]octanoic acid |
| SMILES | Cc1nc(C(=O)NCCCCCCCC(=O)O)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H24N2O4/c1-14-21-17(18(25-14)15-10-6-5-7-11-15)19(24)20-13-9-4-2-3-8-12-16(22)23/h5-7,10-11H,2-4,8-9,12-13H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | BCTVSDGFSSUSML-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|