C15H19N3O2 — CID 110371856
N-butyl-2-(5-methyl-2-pyridin-3-yl-1,3-oxazol-4-yl)acetamide (PubChem CID 110371856) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is N-butyl-2-(5-methyl-2-pyridin-3-yl-1,3-oxazol-4-yl)acetamide.
| Compound Name | N-butyl-2-(5-methyl-2-pyridin-3-yl-1,3-oxazol-4-yl)acetamide |
|---|---|
| PubChem CID | 110371856 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-butyl-2-(5-methyl-2-pyridin-3-yl-1,3-oxazol-4-yl)acetamide |
| SMILES | CCCCNC(=O)Cc1nc(-c2cccnc2)oc1C |
| InChI | InChI=1S/C15H19N3O2/c1-3-4-8-17-14(19)9-13-11(2)20-15(18-13)12-6-5-7-16-10-12/h5-7,10H,3-4,8-9H2,1-2H3,(H,17,19) |
| InChIKey | KNBXQNYMBXYENR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|