C21H29N3O3 — CID 110630679
N-(3-acetamidopropyl)-2-[2-(4-tert-butylphenyl)-5-methyl-1,3-oxazol-4-yl]acetamide (PubChem CID 110630679) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-(3-acetamidopropyl)-2-[2-(4-tert-butylphenyl)-5-methyl-1,3-oxazol-4-yl]acetamide.
| Compound Name | N-(3-acetamidopropyl)-2-[2-(4-tert-butylphenyl)-5-methyl-1,3-oxazol-4-yl]acetamide |
|---|---|
| PubChem CID | 110630679 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-(3-acetamidopropyl)-2-[2-(4-tert-butylphenyl)-5-methyl-1,3-oxazol-4-yl]acetamide |
| SMILES | CC(=O)NCCCNC(=O)Cc1nc(-c2ccc(C(C)(C)C)cc2)oc1C |
| InChI | InChI=1S/C21H29N3O3/c1-14-18(13-19(26)23-12-6-11-22-15(2)25)24-20(27-14)16-7-9-17(10-8-16)21(3,4)5/h7-10H,6,11-13H2,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | ZOQMMOSNYDZBCW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|