C20H28N2O3 — CID 110610248
N-(4-methoxybutyl)-2-[5-methyl-2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]acetamide (PubChem CID 110610248) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(4-methoxybutyl)-2-[5-methyl-2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]acetamide.
| Compound Name | N-(4-methoxybutyl)-2-[5-methyl-2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]acetamide |
|---|---|
| PubChem CID | 110610248 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-(4-methoxybutyl)-2-[5-methyl-2-(4-propan-2-ylphenyl)-1,3-oxazol-4-yl]acetamide |
| SMILES | COCCCCNC(=O)Cc1nc(-c2ccc(C(C)C)cc2)oc1C |
| InChI | InChI=1S/C20H28N2O3/c1-14(2)16-7-9-17(10-8-16)20-22-18(15(3)25-20)13-19(23)21-11-5-6-12-24-4/h7-10,14H,5-6,11-13H2,1-4H3,(H,21,23) |
| InChIKey | VSVHLIBOZBZPGN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|