C18H22N2O5 — CID 110610249
2-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,3-oxazol-4-yl]-N-(4-methoxybutyl)acetamide (PubChem CID 110610249) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,3-oxazol-4-yl]-N-(4-methoxybutyl)acetamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,3-oxazol-4-yl]-N-(4-methoxybutyl)acetamide |
|---|---|
| PubChem CID | 110610249 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,3-oxazol-4-yl]-N-(4-methoxybutyl)acetamide |
| SMILES | COCCCCNC(=O)Cc1nc(-c2ccc3c(c2)OCO3)oc1C |
| InChI | InChI=1S/C18H22N2O5/c1-12-14(10-17(21)19-7-3-4-8-22-2)20-18(25-12)13-5-6-15-16(9-13)24-11-23-15/h5-6,9H,3-4,7-8,10-11H2,1-2H3,(H,19,21) |
| InChIKey | ZOTPBPHELHAWPF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|