C17H15FN4O — CID 24962765
4-[(E)-but-2-enoxy]-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 24962765) has the molecular formula C17H15FN4O and a molecular weight of 310.33 g/mol. Its IUPAC name is 4-[(E)-but-2-enoxy]-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-[(E)-but-2-enoxy]-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 24962765 |
| Molecular Formula | C17H15FN4O |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 4-[(E)-but-2-enoxy]-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | C/C=C/COc1nc(N)nc2ccc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C17H15FN4O/c1-2-3-10-23-16-15-14(21-17(19)22-16)9-8-13(20-15)11-4-6-12(18)7-5-11/h2-9H,10H2,1H3,(H2,19,21,22)/b3-2+ |
| InChIKey | LCUYSLFJOFGGQE-NSCUHMNNSA-N |
| XLogP | 3.37 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|