C16H14FN5O2 — CID 69033636
4-(2-amino-4-ethoxypyrido[3,2-d]pyrimidin-6-yl)-2-fluorobenzamide (PubChem CID 69033636) has the molecular formula C16H14FN5O2 and a molecular weight of 327.32 g/mol. Its IUPAC name is 4-(2-amino-4-ethoxypyrido[3,2-d]pyrimidin-6-yl)-2-fluorobenzamide.
| Compound Name | 4-(2-amino-4-ethoxypyrido[3,2-d]pyrimidin-6-yl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 69033636 |
| Molecular Formula | C16H14FN5O2 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-(2-amino-4-ethoxypyrido[3,2-d]pyrimidin-6-yl)-2-fluorobenzamide |
| SMILES | CCOc1nc(N)nc2ccc(-c3ccc(C(N)=O)c(F)c3)nc12 |
| InChI | InChI=1S/C16H14FN5O2/c1-2-24-15-13-12(21-16(19)22-15)6-5-11(20-13)8-3-4-9(14(18)23)10(17)7-8/h3-7H,2H2,1H3,(H2,18,23)(H2,19,21,22) |
| InChIKey | JWIIYYDEZACTMT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |