About 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine
4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine (PubChem CID 69078731) has the molecular formula C19H22FN5O2
and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine.
Molecular Properties
| Compound Name | 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine |
| PubChem CID | 69078731 |
| Molecular Formula | C19H22FN5O2 |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine |
| SMILES | C1COCCN1.CCOc1nc(N)nc2ccc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C15H13FN4O.C4H9NO/c1-2-21-14-13-12(19-15(17)20-14)8-7-11(18-13)9-3-5-10(16)6-4-9;1-3-6-4-2-5-1/h3-8H,2H2,1H3,(H2,17,19,20);5H,1-4H2 |
| InChIKey | VFUYWWHXUOSTMI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine?
The IUPAC name of 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine (CID 69078731) is 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine.
What is the SMILES notation for 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine?
The canonical SMILES for 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine is C1COCCN1.CCOc1nc(N)nc2ccc(-c3ccc(F)cc3)nc12.
What is the InChIKey of 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine?
The InChIKey is VFUYWWHXUOSTMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN4O.C4H9NO/c1-2-21-14-13-12(19-15(17)20-14)8-7-11(18-13)9-3-5-10(16)6-4-9;1-3-6-4-2-5-1/h3-8H,2H2,1H3,(H2,17,19,20);5H,1-4H2.
What are the key properties of 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine?
4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine has a molecular weight of 371.42 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine;morpholine is sourced from PubChem (CID 69078731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).