C19H19FN4O — CID 24958393
4-cyclohexyloxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 24958393) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is 4-cyclohexyloxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-cyclohexyloxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 24958393 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-cyclohexyloxy-6-(4-fluorophenyl)pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1nc(OC2CCCCC2)c2nc(-c3ccc(F)cc3)ccc2n1 |
| InChI | InChI=1S/C19H19FN4O/c20-13-8-6-12(7-9-13)15-10-11-16-17(22-15)18(24-19(21)23-16)25-14-4-2-1-3-5-14/h6-11,14H,1-5H2,(H2,21,23,24) |
| InChIKey | XBMASGNJMYTJIW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |