C12H13ClN4O2 — CID 24958394
6-chloro-4-(oxan-4-yloxy)pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 24958394) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.71 g/mol. Its IUPAC name is 6-chloro-4-(oxan-4-yloxy)pyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 6-chloro-4-(oxan-4-yloxy)pyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 24958394 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 6-chloro-4-(oxan-4-yloxy)pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1nc(OC2CCOCC2)c2nc(Cl)ccc2n1 |
| InChI | InChI=1S/C12H13ClN4O2/c13-9-2-1-8-10(16-9)11(17-12(14)15-8)19-7-3-5-18-6-4-7/h1-2,7H,3-6H2,(H2,14,15,17) |
| InChIKey | LEAKPVUJUIOKAR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|