C18H17ClN4O3S — CID 91050562
6-chloro-4-cyclopropyloxy-N-[(4-methylsulfonylphenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 91050562) has the molecular formula C18H17ClN4O3S and a molecular weight of 404.88 g/mol. Its IUPAC name is 6-chloro-4-cyclopropyloxy-N-[(4-methylsulfonylphenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 6-chloro-4-cyclopropyloxy-N-[(4-methylsulfonylphenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 91050562 |
| Molecular Formula | C18H17ClN4O3S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 6-chloro-4-cyclopropyloxy-N-[(4-methylsulfonylphenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(CNc2nc(OC3CC3)c3nc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C18H17ClN4O3S/c1-27(24,25)13-6-2-11(3-7-13)10-20-18-21-14-8-9-15(19)22-16(14)17(23-18)26-12-4-5-12/h2-3,6-9,12H,4-5,10H2,1H3,(H,20,21,23) |
| InChIKey | FKPYLJKOJGUJLF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|