C23H22N6O3S — CID 69319698
4-[[[6-(4-aminophenyl)-4-cyclopropyloxypyrido[3,2-d]pyrimidin-2-yl]amino]methyl]benzenesulfonamide (PubChem CID 69319698) has the molecular formula C23H22N6O3S and a molecular weight of 462.54 g/mol. Its IUPAC name is 4-[[[6-(4-aminophenyl)-4-cyclopropyloxypyrido[3,2-d]pyrimidin-2-yl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[6-(4-aminophenyl)-4-cyclopropyloxypyrido[3,2-d]pyrimidin-2-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 69319698 |
| Molecular Formula | C23H22N6O3S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 4-[[[6-(4-aminophenyl)-4-cyclopropyloxypyrido[3,2-d]pyrimidin-2-yl]amino]methyl]benzenesulfonamide |
| SMILES | Nc1ccc(-c2ccc3nc(NCc4ccc(S(N)(=O)=O)cc4)nc(OC4CC4)c3n2)cc1 |
| InChI | InChI=1S/C23H22N6O3S/c24-16-5-3-15(4-6-16)19-11-12-20-21(27-19)22(32-17-7-8-17)29-23(28-20)26-13-14-1-9-18(10-2-14)33(25,30)31/h1-6,9-12,17H,7-8,13,24H2,(H2,25,30,31)(H,26,28,29) |
| InChIKey | MLPBWTLZQUGVKY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 146.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|