C16H16ClN5O3S — CID 59767233
4-[[(6-chloro-4-ethoxypyrido[3,2-d]pyrimidin-2-yl)amino]methyl]benzenesulfonamide (PubChem CID 59767233) has the molecular formula C16H16ClN5O3S and a molecular weight of 393.86 g/mol. Its IUPAC name is 4-[[(6-chloro-4-ethoxypyrido[3,2-d]pyrimidin-2-yl)amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[(6-chloro-4-ethoxypyrido[3,2-d]pyrimidin-2-yl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59767233 |
| Molecular Formula | C16H16ClN5O3S |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 4-[[(6-chloro-4-ethoxypyrido[3,2-d]pyrimidin-2-yl)amino]methyl]benzenesulfonamide |
| SMILES | CCOc1nc(NCc2ccc(S(N)(=O)=O)cc2)nc2ccc(Cl)nc12 |
| InChI | InChI=1S/C16H16ClN5O3S/c1-2-25-15-14-12(7-8-13(17)21-14)20-16(22-15)19-9-10-3-5-11(6-4-10)26(18,23)24/h3-8H,2,9H2,1H3,(H2,18,23,24)(H,19,20,22) |
| InChIKey | IJKWJWHSWJZXDB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|