C24H24N6O4S — CID 68599575
[4-[4-ethoxy-2-[(4-sulfamoylphenyl)methylamino]quinazolin-6-yl]phenyl]urea (PubChem CID 68599575) has the molecular formula C24H24N6O4S and a molecular weight of 492.56 g/mol. Its IUPAC name is [4-[4-ethoxy-2-[(4-sulfamoylphenyl)methylamino]quinazolin-6-yl]phenyl]urea.
| Compound Name | [4-[4-ethoxy-2-[(4-sulfamoylphenyl)methylamino]quinazolin-6-yl]phenyl]urea |
|---|---|
| PubChem CID | 68599575 |
| Molecular Formula | C24H24N6O4S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [4-[4-ethoxy-2-[(4-sulfamoylphenyl)methylamino]quinazolin-6-yl]phenyl]urea |
| SMILES | CCOc1nc(NCc2ccc(S(N)(=O)=O)cc2)nc2ccc(-c3ccc(NC(N)=O)cc3)cc12 |
| InChI | InChI=1S/C24H24N6O4S/c1-2-34-22-20-13-17(16-5-8-18(9-6-16)28-23(25)31)7-12-21(20)29-24(30-22)27-14-15-3-10-19(11-4-15)35(26,32)33/h3-13H,2,14H2,1H3,(H3,25,28,31)(H2,26,32,33)(H,27,29,30) |
| InChIKey | IJPDSEVBTOTUST-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 162.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |