C22H20FN5O — CID 69319400
6-(3-aminophenyl)-4-ethoxy-N-[(4-fluorophenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 69319400) has the molecular formula C22H20FN5O and a molecular weight of 389.43 g/mol. Its IUPAC name is 6-(3-aminophenyl)-4-ethoxy-N-[(4-fluorophenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 6-(3-aminophenyl)-4-ethoxy-N-[(4-fluorophenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 69319400 |
| Molecular Formula | C22H20FN5O |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 6-(3-aminophenyl)-4-ethoxy-N-[(4-fluorophenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | CCOc1nc(NCc2ccc(F)cc2)nc2ccc(-c3cccc(N)c3)nc12 |
| InChI | InChI=1S/C22H20FN5O/c1-2-29-21-20-19(11-10-18(26-20)15-4-3-5-17(24)12-15)27-22(28-21)25-13-14-6-8-16(23)9-7-14/h3-12H,2,13,24H2,1H3,(H,25,27,28) |
| InChIKey | DESFTFRLDBTRSL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|