C23H20FN5O2 — CID 25004607
1-[2-[4-ethoxy-2-[(4-fluorophenyl)methylamino]pteridin-6-yl]phenyl]ethanone (PubChem CID 25004607) has the molecular formula C23H20FN5O2 and a molecular weight of 417.44 g/mol. Its IUPAC name is 1-[2-[4-ethoxy-2-[(4-fluorophenyl)methylamino]pteridin-6-yl]phenyl]ethanone.
| Compound Name | 1-[2-[4-ethoxy-2-[(4-fluorophenyl)methylamino]pteridin-6-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 25004607 |
| Molecular Formula | C23H20FN5O2 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 1-[2-[4-ethoxy-2-[(4-fluorophenyl)methylamino]pteridin-6-yl]phenyl]ethanone |
| SMILES | CCOc1nc(NCc2ccc(F)cc2)nc2ncc(-c3ccccc3C(C)=O)nc12 |
| InChI | InChI=1S/C23H20FN5O2/c1-3-31-22-20-21(28-23(29-22)26-12-15-8-10-16(24)11-9-15)25-13-19(27-20)18-7-5-4-6-17(18)14(2)30/h4-11,13H,3,12H2,1-2H3,(H,25,26,28,29) |
| InChIKey | SHDYHPAQDLOPLE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |