C21H17F2N5O — CID 25007510
4-ethoxy-6-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]pteridin-2-amine (PubChem CID 25007510) has the molecular formula C21H17F2N5O and a molecular weight of 393.40 g/mol. Its IUPAC name is 4-ethoxy-6-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]pteridin-2-amine.
| Compound Name | 4-ethoxy-6-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]pteridin-2-amine |
|---|---|
| PubChem CID | 25007510 |
| Molecular Formula | C21H17F2N5O |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-ethoxy-6-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]pteridin-2-amine |
| SMILES | CCOc1nc(NCc2ccc(F)cc2)nc2ncc(-c3ccccc3F)nc12 |
| InChI | InChI=1S/C21H17F2N5O/c1-2-29-20-18-19(24-12-17(26-18)15-5-3-4-6-16(15)23)27-21(28-20)25-11-13-7-9-14(22)10-8-13/h3-10,12H,2,11H2,1H3,(H,24,25,27,28) |
| InChIKey | COZLATNSUJWVPY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |