C22H23N5O3S — CID 58275528
4-[(1R)-1-[[6-(2-cyclopropylethynyl)-4-ethoxypyrido[3,2-d]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide (PubChem CID 58275528) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 4-[(1R)-1-[[6-(2-cyclopropylethynyl)-4-ethoxypyrido[3,2-d]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[(1R)-1-[[6-(2-cyclopropylethynyl)-4-ethoxypyrido[3,2-d]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58275528 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-[(1R)-1-[[6-(2-cyclopropylethynyl)-4-ethoxypyrido[3,2-d]pyrimidin-2-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CCOc1nc(N[C@H](C)c2ccc(S(N)(=O)=O)cc2)nc2ccc(C#CC3CC3)nc12 |
| InChI | InChI=1S/C22H23N5O3S/c1-3-30-21-20-19(13-10-17(25-20)9-6-15-4-5-15)26-22(27-21)24-14(2)16-7-11-18(12-8-16)31(23,28)29/h7-8,10-15H,3-5H2,1-2H3,(H2,23,28,29)(H,24,26,27)/t14-/m1/s1 |
| InChIKey | ZBMJSPOWRTYNQC-CQSZACIVSA-N |
| XLogP | 3.01 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|