C21H24N6O2 — CID 66810336
4-[2-amino-4-(3-methoxypropylamino)pyrido[3,2-d]pyrimidin-6-yl]-N-cyclopropylbenzamide (PubChem CID 66810336) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-[2-amino-4-(3-methoxypropylamino)pyrido[3,2-d]pyrimidin-6-yl]-N-cyclopropylbenzamide.
| Compound Name | 4-[2-amino-4-(3-methoxypropylamino)pyrido[3,2-d]pyrimidin-6-yl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 66810336 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 4-[2-amino-4-(3-methoxypropylamino)pyrido[3,2-d]pyrimidin-6-yl]-N-cyclopropylbenzamide |
| SMILES | COCCCNc1nc(N)nc2ccc(-c3ccc(C(=O)NC4CC4)cc3)nc12 |
| InChI | InChI=1S/C21H24N6O2/c1-29-12-2-11-23-19-18-17(26-21(22)27-19)10-9-16(25-18)13-3-5-14(6-4-13)20(28)24-15-7-8-15/h3-6,9-10,15H,2,7-8,11-12H2,1H3,(H,24,28)(H3,22,23,26,27) |
| InChIKey | NXXCTICUZYJHCD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|