C19H22N6O3 — CID 66810251
methyl N-[4-[2-amino-4-(2-ethoxyethylamino)pyrido[3,2-d]pyrimidin-6-yl]phenyl]carbamate (PubChem CID 66810251) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl N-[4-[2-amino-4-(2-ethoxyethylamino)pyrido[3,2-d]pyrimidin-6-yl]phenyl]carbamate.
| Compound Name | methyl N-[4-[2-amino-4-(2-ethoxyethylamino)pyrido[3,2-d]pyrimidin-6-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 66810251 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | methyl N-[4-[2-amino-4-(2-ethoxyethylamino)pyrido[3,2-d]pyrimidin-6-yl]phenyl]carbamate |
| SMILES | CCOCCNc1nc(N)nc2ccc(-c3ccc(NC(=O)OC)cc3)nc12 |
| InChI | InChI=1S/C19H22N6O3/c1-3-28-11-10-21-17-16-15(24-18(20)25-17)9-8-14(23-16)12-4-6-13(7-5-12)22-19(26)27-2/h4-9H,3,10-11H2,1-2H3,(H,22,26)(H3,20,21,24,25) |
| InChIKey | WHTNGDWQJSCPRA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|