C11H20N4 — CID 114786676
N-hexan-2-yl-5,6-dimethyl-1,2,4-triazin-3-amine (PubChem CID 114786676) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N-hexan-2-yl-5,6-dimethyl-1,2,4-triazin-3-amine.
| Compound Name | N-hexan-2-yl-5,6-dimethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 114786676 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N-hexan-2-yl-5,6-dimethyl-1,2,4-triazin-3-amine |
| SMILES | CCCCC(C)Nc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C11H20N4/c1-5-6-7-8(2)12-11-13-9(3)10(4)14-15-11/h8H,5-7H2,1-4H3,(H,12,13,15) |
| InChIKey | ZXOGMTYQSJSQLN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |