C11H21N3 — CID 43777198
N-hexan-2-yl-3,5-dimethyl-1H-pyrazol-4-amine (PubChem CID 43777198) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N-hexan-2-yl-3,5-dimethyl-1H-pyrazol-4-amine.
| Compound Name | N-hexan-2-yl-3,5-dimethyl-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43777198 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N-hexan-2-yl-3,5-dimethyl-1H-pyrazol-4-amine |
| SMILES | CCCCC(C)Nc1c(C)n[nH]c1C |
| InChI | InChI=1S/C11H21N3/c1-5-6-7-8(2)12-11-9(3)13-14-10(11)4/h8,12H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | PKZYNQCYBUNTEB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |