C6H12ClN3 — CID 56773738
N,3,5-trimethyl-1H-pyrazol-4-amine;hydrochloride (PubChem CID 56773738) has the molecular formula C6H12ClN3 and a molecular weight of 161.64 g/mol. Its IUPAC name is N,3,5-trimethyl-1H-pyrazol-4-amine;hydrochloride.
| Compound Name | N,3,5-trimethyl-1H-pyrazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 56773738 |
| Molecular Formula | C6H12ClN3 |
| Molecular Weight | 161.64 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | N,3,5-trimethyl-1H-pyrazol-4-amine;hydrochloride |
| SMILES | CNc1c(C)n[nH]c1C.Cl |
| InChI | InChI=1S/C6H11N3.ClH/c1-4-6(7-3)5(2)9-8-4;/h7H,1-3H3,(H,8,9);1H |
| InChIKey | UPTMVPWHTOPWBM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.64 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |