C9H17N3 — CID 43547378
3,5-dimethyl-N-(2-methylpropyl)-1H-pyrazol-4-amine (PubChem CID 43547378) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 3,5-dimethyl-N-(2-methylpropyl)-1H-pyrazol-4-amine.
| Compound Name | 3,5-dimethyl-N-(2-methylpropyl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43547378 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 3,5-dimethyl-N-(2-methylpropyl)-1H-pyrazol-4-amine |
| SMILES | Cc1n[nH]c(C)c1NCC(C)C |
| InChI | InChI=1S/C9H17N3/c1-6(2)5-10-9-7(3)11-12-8(9)4/h6,10H,5H2,1-4H3,(H,11,12) |
| InChIKey | DEYJGMKIOVZHRM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |