C12H20ClN3 — CID 63271524
6-chloro-N-hexan-2-yl-4,5-dimethylpyridazin-3-amine (PubChem CID 63271524) has the molecular formula C12H20ClN3 and a molecular weight of 241.77 g/mol. Its IUPAC name is 6-chloro-N-hexan-2-yl-4,5-dimethylpyridazin-3-amine.
| Compound Name | 6-chloro-N-hexan-2-yl-4,5-dimethylpyridazin-3-amine |
|---|---|
| PubChem CID | 63271524 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 6-chloro-N-hexan-2-yl-4,5-dimethylpyridazin-3-amine |
| SMILES | CCCCC(C)Nc1nnc(Cl)c(C)c1C |
| InChI | InChI=1S/C12H20ClN3/c1-5-6-7-8(2)14-12-10(4)9(3)11(13)15-16-12/h8H,5-7H2,1-4H3,(H,14,16) |
| InChIKey | GCCRBOVUKOGAJU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |