C9H13Cl2N5O — CID 81036335
2-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-N-propylpropanamide (PubChem CID 81036335) has the molecular formula C9H13Cl2N5O and a molecular weight of 278.14 g/mol. Its IUPAC name is 2-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-N-propylpropanamide.
| Compound Name | 2-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 81036335 |
| Molecular Formula | C9H13Cl2N5O |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[(3,6-dichloro-1,2,4-triazin-5-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Nc1nc(Cl)nnc1Cl |
| InChI | InChI=1S/C9H13Cl2N5O/c1-3-4-12-8(17)5(2)13-7-6(10)15-16-9(11)14-7/h5H,3-4H2,1-2H3,(H,12,17)(H,13,14,16) |
| InChIKey | LDYUTMOGDJJMMF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |