C9H14ClN3OS — CID 83152529
2-[(4-chloro-1,3-thiazol-2-yl)amino]-N-propylpropanamide (PubChem CID 83152529) has the molecular formula C9H14ClN3OS and a molecular weight of 247.75 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-thiazol-2-yl)amino]-N-propylpropanamide.
| Compound Name | 2-[(4-chloro-1,3-thiazol-2-yl)amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 83152529 |
| Molecular Formula | C9H14ClN3OS |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-[(4-chloro-1,3-thiazol-2-yl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Nc1nc(Cl)cs1 |
| InChI | InChI=1S/C9H14ClN3OS/c1-3-4-11-8(14)6(2)12-9-13-7(10)5-15-9/h5-6H,3-4H2,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | ITOPARCEUVBYBN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |