C12H19Cl2N3 — CID 102755564
3,5-dichloro-2-N-ethyl-6-N-pentan-2-ylpyridine-2,6-diamine (PubChem CID 102755564) has the molecular formula C12H19Cl2N3 and a molecular weight of 276.21 g/mol. Its IUPAC name is 3,5-dichloro-2-N-ethyl-6-N-pentan-2-ylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-2-N-ethyl-6-N-pentan-2-ylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 102755564 |
| Molecular Formula | C12H19Cl2N3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3,5-dichloro-2-N-ethyl-6-N-pentan-2-ylpyridine-2,6-diamine |
| SMILES | CCCC(C)Nc1nc(NCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H19Cl2N3/c1-4-6-8(3)16-12-10(14)7-9(13)11(17-12)15-5-2/h7-8H,4-6H2,1-3H3,(H2,15,16,17) |
| InChIKey | AYVQVHVBJRUQKY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |