C12H18Cl2N4O — CID 102759989
3-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]amino]butanamide (PubChem CID 102759989) has the molecular formula C12H18Cl2N4O and a molecular weight of 305.21 g/mol. Its IUPAC name is 3-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]amino]butanamide.
| Compound Name | 3-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]amino]butanamide |
|---|---|
| PubChem CID | 102759989 |
| Molecular Formula | C12H18Cl2N4O |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3-[[3,5-dichloro-6-(propylamino)-2-pyridinyl]amino]butanamide |
| SMILES | CCCNc1nc(NC(C)CC(N)=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N4O/c1-3-4-16-11-8(13)6-9(14)12(18-11)17-7(2)5-10(15)19/h6-7H,3-5H2,1-2H3,(H2,15,19)(H2,16,17,18) |
| InChIKey | QBPAIVNMHHSLOP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |