C15H25Cl2N3 — CID 106028744
3,5-dichloro-2-N-ethyl-6-N-octan-4-ylpyridine-2,6-diamine (PubChem CID 106028744) has the molecular formula C15H25Cl2N3 and a molecular weight of 318.29 g/mol. Its IUPAC name is 3,5-dichloro-2-N-ethyl-6-N-octan-4-ylpyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-2-N-ethyl-6-N-octan-4-ylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 106028744 |
| Molecular Formula | C15H25Cl2N3 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3,5-dichloro-2-N-ethyl-6-N-octan-4-ylpyridine-2,6-diamine |
| SMILES | CCCCC(CCC)Nc1nc(NCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H25Cl2N3/c1-4-7-9-11(8-5-2)19-15-13(17)10-12(16)14(20-15)18-6-3/h10-11H,4-9H2,1-3H3,(H2,18,19,20) |
| InChIKey | VGQQONBNUDYBSY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |