C11H16Cl2N2 — CID 106659441
6-butyl-3,5-dichloro-N-ethylpyridin-2-amine (PubChem CID 106659441) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine.
| Compound Name | 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 106659441 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine |
| SMILES | CCCCc1nc(NCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H16Cl2N2/c1-3-5-6-10-8(12)7-9(13)11(15-10)14-4-2/h7H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | XCOIYYBRHSBNIM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |