About 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine
6-butyl-3,5-dichloro-N-ethylpyridin-2-amine (PubChem CID 106659441) has the molecular formula C11H16Cl2N2
and a molecular weight of 247.17 g/mol. Its IUPAC name is 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine.
Molecular Properties
| Compound Name | 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine |
| PubChem CID | 106659441 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine |
| SMILES | CCCCc1nc(NCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H16Cl2N2/c1-3-5-6-10-8(12)7-9(13)11(15-10)14-4-2/h7H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | XCOIYYBRHSBNIM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine?
The IUPAC name of 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine (CID 106659441) is 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine.
What is the SMILES notation for 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine?
The canonical SMILES for 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine is CCCCc1nc(NCC)c(Cl)cc1Cl.
What is the InChIKey of 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine?
The InChIKey is XCOIYYBRHSBNIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16Cl2N2/c1-3-5-6-10-8(12)7-9(13)11(15-10)14-4-2/h7H,3-6H2,1-2H3,(H,14,15).
What are the key properties of 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine?
6-butyl-3,5-dichloro-N-ethylpyridin-2-amine has a molecular weight of 247.17 g/mol, XLogP of 4.16, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-3,5-dichloro-N-ethylpyridin-2-amine is sourced from PubChem (CID 106659441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).