C10H11Cl2N5 — CID 102756813
3,5-dichloro-6-N-(2-pyrazol-1-ylethyl)pyridine-2,6-diamine (PubChem CID 102756813) has the molecular formula C10H11Cl2N5 and a molecular weight of 272.14 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(2-pyrazol-1-ylethyl)pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(2-pyrazol-1-ylethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102756813 |
| Molecular Formula | C10H11Cl2N5 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 3,5-dichloro-6-N-(2-pyrazol-1-ylethyl)pyridine-2,6-diamine |
| SMILES | Nc1nc(NCCn2cccn2)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2N5/c11-7-6-8(12)10(16-9(7)13)14-3-5-17-4-1-2-15-17/h1-2,4,6H,3,5H2,(H3,13,14,16) |
| InChIKey | AJYVDVPBIBMWKE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |