C12H18Cl2N4O — CID 102755807
3,5-dichloro-6-N-(3-morpholin-4-ylpropyl)pyridine-2,6-diamine (PubChem CID 102755807) has the molecular formula C12H18Cl2N4O and a molecular weight of 305.21 g/mol. Its IUPAC name is 3,5-dichloro-6-N-(3-morpholin-4-ylpropyl)pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-6-N-(3-morpholin-4-ylpropyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102755807 |
| Molecular Formula | C12H18Cl2N4O |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3,5-dichloro-6-N-(3-morpholin-4-ylpropyl)pyridine-2,6-diamine |
| SMILES | Nc1nc(NCCCN2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N4O/c13-9-8-10(14)12(17-11(9)15)16-2-1-3-18-4-6-19-7-5-18/h8H,1-7H2,(H3,15,16,17) |
| InChIKey | NBAJIHICMSVZBU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|