C10H15Cl2N5O — CID 81035323
3,6-dichloro-N-(3-morpholin-4-ylpropyl)-1,2,4-triazin-5-amine (PubChem CID 81035323) has the molecular formula C10H15Cl2N5O and a molecular weight of 292.17 g/mol. Its IUPAC name is 3,6-dichloro-N-(3-morpholin-4-ylpropyl)-1,2,4-triazin-5-amine.
| Compound Name | 3,6-dichloro-N-(3-morpholin-4-ylpropyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 81035323 |
| Molecular Formula | C10H15Cl2N5O |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3,6-dichloro-N-(3-morpholin-4-ylpropyl)-1,2,4-triazin-5-amine |
| SMILES | Clc1nnc(Cl)c(NCCCN2CCOCC2)n1 |
| InChI | InChI=1S/C10H15Cl2N5O/c11-8-9(14-10(12)16-15-8)13-2-1-3-17-4-6-18-7-5-17/h1-7H2,(H,13,14,16) |
| InChIKey | OVUDAHYJWMOODI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|