C16H24Cl2N4O — CID 88906606
2,6-dichloro-5-cyclopentyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine (PubChem CID 88906606) has the molecular formula C16H24Cl2N4O and a molecular weight of 359.30 g/mol. Its IUPAC name is 2,6-dichloro-5-cyclopentyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine.
| Compound Name | 2,6-dichloro-5-cyclopentyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 88906606 |
| Molecular Formula | C16H24Cl2N4O |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2,6-dichloro-5-cyclopentyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine |
| SMILES | Clc1nc(Cl)c(C2CCCC2)c(NCCCN2CCOCC2)n1 |
| InChI | InChI=1S/C16H24Cl2N4O/c17-14-13(12-4-1-2-5-12)15(21-16(18)20-14)19-6-3-7-22-8-10-23-11-9-22/h12H,1-11H2,(H,19,20,21) |
| InChIKey | GFUOHHTVKXBZKQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|