C13H15Cl3N4O — CID 36662494
2,4,5-trichloro-6-(3-morpholin-4-ylpropylamino)pyridine-3-carbonitrile (PubChem CID 36662494) has the molecular formula C13H15Cl3N4O and a molecular weight of 349.65 g/mol. Its IUPAC name is 2,4,5-trichloro-6-(3-morpholin-4-ylpropylamino)pyridine-3-carbonitrile.
| Compound Name | 2,4,5-trichloro-6-(3-morpholin-4-ylpropylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 36662494 |
| Molecular Formula | C13H15Cl3N4O |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2,4,5-trichloro-6-(3-morpholin-4-ylpropylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(Cl)nc(NCCCN2CCOCC2)c(Cl)c1Cl |
| InChI | InChI=1S/C13H15Cl3N4O/c14-10-9(8-17)12(16)19-13(11(10)15)18-2-1-3-20-4-6-21-7-5-20/h1-7H2,(H,18,19) |
| InChIKey | QQXYLJGPSMITDJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|