C12H18BN5O — CID 162381502
CID 162381502 (PubChem CID 162381502) has the molecular formula C12H18BN5O and a molecular weight of 259.12 g/mol.
| Compound Name | CID 162381502 |
|---|---|
| PubChem CID | 162381502 |
| Molecular Formula | C12H18BN5O |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | — |
| SMILES | [B]c1nn(C)c(NCCCN2CCOCC2)c1C#N |
| InChI | InChI=1S/C12H18BN5O/c1-17-12(10(9-14)11(13)16-17)15-3-2-4-18-5-7-19-8-6-18/h15H,2-8H2,1H3 |
| InChIKey | BLQGXTGSUKRRBT-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 66.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|