C19H24N6O2 — CID 76506743
4-amino-6-(4-methoxyphenyl)-2-(3-morpholin-4-ylpropylamino)pyrimidine-5-carbonitrile (PubChem CID 76506743) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 4-amino-6-(4-methoxyphenyl)-2-(3-morpholin-4-ylpropylamino)pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-(4-methoxyphenyl)-2-(3-morpholin-4-ylpropylamino)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 76506743 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 4-amino-6-(4-methoxyphenyl)-2-(3-morpholin-4-ylpropylamino)pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(NCCCN3CCOCC3)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C19H24N6O2/c1-26-15-5-3-14(4-6-15)17-16(13-20)18(21)24-19(23-17)22-7-2-8-25-9-11-27-12-10-25/h3-6H,2,7-12H2,1H3,(H3,21,22,23,24) |
| InChIKey | IRLAPJMQTNKWEQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|